C15H9F6O3S- — CID 57304198
4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]benzenesulfinate (PubChem CID 57304198) has the molecular formula C15H9F6O3S- and a molecular weight of 383.29 g/mol. Its IUPAC name is 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]benzenesulfinate.
| Compound Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]benzenesulfinate |
|---|---|
| PubChem CID | 57304198 |
| Molecular Formula | C15H9F6O3S- |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]benzenesulfinate |
| SMILES | O=S([O-])c1ccc(OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H10F6O3S/c16-14(17,18)10-5-9(6-11(7-10)15(19,20)21)8-24-12-1-3-13(4-2-12)25(22)23/h1-7H,8H2,(H,22,23)/p-1 |
| InChIKey | SKYZLSNONWELMH-UHFFFAOYSA-M |
| XLogP | 4.54 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|