C12H26O2 — CID 57304463
4-(3,3-dimethylbutan-2-yloxy)-2,3-dimethylbutan-2-ol (PubChem CID 57304463) has the molecular formula C12H26O2 and a molecular weight of 202.34 g/mol. Its IUPAC name is 4-(3,3-dimethylbutan-2-yloxy)-2,3-dimethylbutan-2-ol.
| Compound Name | 4-(3,3-dimethylbutan-2-yloxy)-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 57304463 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 4-(3,3-dimethylbutan-2-yloxy)-2,3-dimethylbutan-2-ol |
| SMILES | CC(OCC(C)C(C)(C)O)C(C)(C)C |
| InChI | InChI=1S/C12H26O2/c1-9(12(6,7)13)8-14-10(2)11(3,4)5/h9-10,13H,8H2,1-7H3 |
| InChIKey | PQRXCOJAHHXBJG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |