About (3S)-2,4-dimethyl-3-propoxypentan-2-ol
(3S)-2,4-dimethyl-3-propoxypentan-2-ol (PubChem CID 58469720) has the molecular formula C10H22O2
and a molecular weight of 174.28 g/mol. Its IUPAC name is (3S)-2,4-dimethyl-3-propoxypentan-2-ol.
Molecular Properties
| Compound Name | (3S)-2,4-dimethyl-3-propoxypentan-2-ol |
| PubChem CID | 58469720 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | (3S)-2,4-dimethyl-3-propoxypentan-2-ol |
| SMILES | CCCO[C@@H](C(C)C)C(C)(C)O |
| InChI | InChI=1S/C10H22O2/c1-6-7-12-9(8(2)3)10(4,5)11/h8-9,11H,6-7H2,1-5H3/t9-/m0/s1 |
| InChIKey | BAHWDLHVDOYEBM-VIFPVBQESA-N |
| XLogP | 2.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-2,4-dimethyl-3-propoxypentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2,4-dimethyl-3-propoxypentan-2-ol?
The IUPAC name of (3S)-2,4-dimethyl-3-propoxypentan-2-ol (CID 58469720) is (3S)-2,4-dimethyl-3-propoxypentan-2-ol.
What is the SMILES notation for (3S)-2,4-dimethyl-3-propoxypentan-2-ol?
The canonical SMILES for (3S)-2,4-dimethyl-3-propoxypentan-2-ol is CCCO[C@@H](C(C)C)C(C)(C)O.
What is the InChIKey of (3S)-2,4-dimethyl-3-propoxypentan-2-ol?
The InChIKey is BAHWDLHVDOYEBM-VIFPVBQESA-N. The full InChI is InChI=1S/C10H22O2/c1-6-7-12-9(8(2)3)10(4,5)11/h8-9,11H,6-7H2,1-5H3/t9-/m0/s1.
What are the key properties of (3S)-2,4-dimethyl-3-propoxypentan-2-ol?
(3S)-2,4-dimethyl-3-propoxypentan-2-ol has a molecular weight of 174.28 g/mol, XLogP of 2.21, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2,4-dimethyl-3-propoxypentan-2-ol is sourced from PubChem (CID 58469720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).