About (3S)-3-[2-(dimethylamino)ethoxy]-2,4-dimethylpentan-2-ol
(3S)-3-[2-(dimethylamino)ethoxy]-2,4-dimethylpentan-2-ol (PubChem CID 89424025) has the molecular formula C11H25NO2
and a molecular weight of 203.33 g/mol. Its IUPAC name is (3S)-3-[2-(dimethylamino)ethoxy]-2,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | (3S)-3-[2-(dimethylamino)ethoxy]-2,4-dimethylpentan-2-ol |
| PubChem CID | 89424025 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | (3S)-3-[2-(dimethylamino)ethoxy]-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)[C@H](OCCN(C)C)C(C)(C)O |
| InChI | InChI=1S/C11H25NO2/c1-9(2)10(11(3,4)13)14-8-7-12(5)6/h9-10,13H,7-8H2,1-6H3/t10-/m0/s1 |
| InChIKey | FYAZMEFWSVJICN-JTQLQIEISA-N |
| XLogP | 1.36 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-[2-(dimethylamino)ethoxy]-2,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[2-(dimethylamino)ethoxy]-2,4-dimethylpentan-2-ol?
The IUPAC name of (3S)-3-[2-(dimethylamino)ethoxy]-2,4-dimethylpentan-2-ol (CID 89424025) is (3S)-3-[2-(dimethylamino)ethoxy]-2,4-dimethylpentan-2-ol.
What is the SMILES notation for (3S)-3-[2-(dimethylamino)ethoxy]-2,4-dimethylpentan-2-ol?
The canonical SMILES for (3S)-3-[2-(dimethylamino)ethoxy]-2,4-dimethylpentan-2-ol is CC(C)[C@H](OCCN(C)C)C(C)(C)O.
What is the InChIKey of (3S)-3-[2-(dimethylamino)ethoxy]-2,4-dimethylpentan-2-ol?
The InChIKey is FYAZMEFWSVJICN-JTQLQIEISA-N. The full InChI is InChI=1S/C11H25NO2/c1-9(2)10(11(3,4)13)14-8-7-12(5)6/h9-10,13H,7-8H2,1-6H3/t10-/m0/s1.
What are the key properties of (3S)-3-[2-(dimethylamino)ethoxy]-2,4-dimethylpentan-2-ol?
(3S)-3-[2-(dimethylamino)ethoxy]-2,4-dimethylpentan-2-ol has a molecular weight of 203.33 g/mol, XLogP of 1.36, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[2-(dimethylamino)ethoxy]-2,4-dimethylpentan-2-ol is sourced from PubChem (CID 89424025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).