C8H19NO3 — CID 123705763
2-[ethoxy(methoxy)methoxy]-N,N-dimethylethanamine (PubChem CID 123705763) has the molecular formula C8H19NO3 and a molecular weight of 177.24 g/mol. Its IUPAC name is 2-[ethoxy(methoxy)methoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[ethoxy(methoxy)methoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 123705763 |
| Molecular Formula | C8H19NO3 |
| Molecular Weight | 177.24 g/mol |
| Exact Mass | 177.14 |
| IUPAC Name | 2-[ethoxy(methoxy)methoxy]-N,N-dimethylethanamine |
| SMILES | CCOC(OC)OCCN(C)C |
| InChI | InChI=1S/C8H19NO3/c1-5-11-8(10-4)12-7-6-9(2)3/h8H,5-7H2,1-4H3 |
| InChIKey | PPJMHQSHIATFGN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|