C11H28N2OSi — CID 88539647
1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine (PubChem CID 88539647) has the molecular formula C11H28N2OSi and a molecular weight of 232.44 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine.
| Compound Name | 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 88539647 |
| Molecular Formula | C11H28N2OSi |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine |
| SMILES | CCC(N(C)C)[Si](C)(C)OCCN(C)C |
| InChI | InChI=1S/C11H28N2OSi/c1-8-11(13(4)5)15(6,7)14-10-9-12(2)3/h11H,8-10H2,1-7H3 |
| InChIKey | BIHIMUZEOZLGGO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|