About 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine
1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine (PubChem CID 88539647) has the molecular formula C11H28N2OSi
and a molecular weight of 232.44 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine |
| PubChem CID | 88539647 |
| Molecular Formula | C11H28N2OSi |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine |
| SMILES | CCC(N(C)C)[Si](C)(C)OCCN(C)C |
| InChI | InChI=1S/C11H28N2OSi/c1-8-11(13(4)5)15(6,7)14-10-9-12(2)3/h11H,8-10H2,1-7H3 |
| InChIKey | BIHIMUZEOZLGGO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine?
The IUPAC name of 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine (CID 88539647) is 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine?
The canonical SMILES for 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine is CCC(N(C)C)[Si](C)(C)OCCN(C)C.
What is the InChIKey of 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine?
The InChIKey is BIHIMUZEOZLGGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H28N2OSi/c1-8-11(13(4)5)15(6,7)14-10-9-12(2)3/h11H,8-10H2,1-7H3.
What are the key properties of 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine?
1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine has a molecular weight of 232.44 g/mol, XLogP of 1.65, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(dimethylamino)ethoxy-dimethylsilyl]-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 88539647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).