C14H32N2OSi — CID 67979932
2-[dimethyl(1-piperidin-1-ylpropyl)silyl]oxy-N,N-dimethylethanamine (PubChem CID 67979932) has the molecular formula C14H32N2OSi and a molecular weight of 272.51 g/mol. Its IUPAC name is 2-[dimethyl(1-piperidin-1-ylpropyl)silyl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[dimethyl(1-piperidin-1-ylpropyl)silyl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 67979932 |
| Molecular Formula | C14H32N2OSi |
| Molecular Weight | 272.51 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 2-[dimethyl(1-piperidin-1-ylpropyl)silyl]oxy-N,N-dimethylethanamine |
| SMILES | CCC(N1CCCCC1)[Si](C)(C)OCCN(C)C |
| InChI | InChI=1S/C14H32N2OSi/c1-6-14(16-10-8-7-9-11-16)18(4,5)17-13-12-15(2)3/h14H,6-13H2,1-5H3 |
| InChIKey | OCVGIRAICBFQAA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|