C17H39N3O2Si — CID 67980139
2-[2-(dimethylamino)ethoxy-methyl-(3-piperidin-1-ylpropyl)silyl]oxy-N,N-dimethylethanamine (PubChem CID 67980139) has the molecular formula C17H39N3O2Si and a molecular weight of 345.60 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy-methyl-(3-piperidin-1-ylpropyl)silyl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[2-(dimethylamino)ethoxy-methyl-(3-piperidin-1-ylpropyl)silyl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 67980139 |
| Molecular Formula | C17H39N3O2Si |
| Molecular Weight | 345.60 g/mol |
| Exact Mass | 345.28 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy-methyl-(3-piperidin-1-ylpropyl)silyl]oxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCO[Si](C)(CCCN1CCCCC1)OCCN(C)C |
| InChI | InChI=1S/C17H39N3O2Si/c1-18(2)13-15-21-23(5,22-16-14-19(3)4)17-9-12-20-10-7-6-8-11-20/h6-17H2,1-5H3 |
| InChIKey | VSNZIUBZAKAUJY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.60 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|