C8H25NO3Si2 — CID 173312185
N,N-dimethyl-1-trimethoxysilylpropan-1-amine;silane (PubChem CID 173312185) has the molecular formula C8H25NO3Si2 and a molecular weight of 239.46 g/mol. Its IUPAC name is N,N-dimethyl-1-trimethoxysilylpropan-1-amine;silane.
| Compound Name | N,N-dimethyl-1-trimethoxysilylpropan-1-amine;silane |
|---|---|
| PubChem CID | 173312185 |
| Molecular Formula | C8H25NO3Si2 |
| Molecular Weight | 239.46 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N,N-dimethyl-1-trimethoxysilylpropan-1-amine;silane |
| SMILES | CCC(N(C)C)[Si](OC)(OC)OC.[SiH4] |
| InChI | InChI=1S/C8H21NO3Si.H4Si/c1-7-8(9(2)3)13(10-4,11-5)12-6;/h8H,7H2,1-6H3;1H4 |
| InChIKey | HUEHRHSBAGLLDL-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.46 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|