C7H18AlNO — CID 139905114
1-dimethylalumanyloxy-N,N-dimethylpropan-1-amine (PubChem CID 139905114) has the molecular formula C7H18AlNO and a molecular weight of 159.21 g/mol. Its IUPAC name is 1-dimethylalumanyloxy-N,N-dimethylpropan-1-amine.
| Compound Name | 1-dimethylalumanyloxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 139905114 |
| Molecular Formula | C7H18AlNO |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.12 |
| IUPAC Name | 1-dimethylalumanyloxy-N,N-dimethylpropan-1-amine |
| SMILES | CCC(O[Al](C)C)N(C)C |
| InChI | InChI=1S/C5H12NO.2CH3.Al/c1-4-5(7)6(2)3;;;/h5H,4H2,1-3H3;2*1H3;/q-1;;;+1 |
| InChIKey | HNAAGZYSABMGPA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|