C19H42AlNO — CID 139905384
1-dihexylalumanyloxy-N,N-diethylpropan-1-amine (PubChem CID 139905384) has the molecular formula C19H42AlNO and a molecular weight of 327.53 g/mol. Its IUPAC name is 1-dihexylalumanyloxy-N,N-diethylpropan-1-amine.
| Compound Name | 1-dihexylalumanyloxy-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 139905384 |
| Molecular Formula | C19H42AlNO |
| Molecular Weight | 327.53 g/mol |
| Exact Mass | 327.31 |
| IUPAC Name | 1-dihexylalumanyloxy-N,N-diethylpropan-1-amine |
| SMILES | CCCCCC[Al](CCCCCC)OC(CC)N(CC)CC |
| InChI | InChI=1S/C7H16NO.2C6H13.Al/c1-4-7(9)8(5-2)6-3;2*1-3-5-6-4-2;/h7H,4-6H2,1-3H3;2*1,3-6H2,2H3;/q-1;;;+1 |
| InChIKey | CEUMDPPJPWMGFB-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.53 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|