C23H50AlNO — CID 139905004
1-dioctylalumanyloxy-N,N-diethylpropan-1-amine (PubChem CID 139905004) has the molecular formula C23H50AlNO and a molecular weight of 383.64 g/mol. Its IUPAC name is 1-dioctylalumanyloxy-N,N-diethylpropan-1-amine.
| Compound Name | 1-dioctylalumanyloxy-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 139905004 |
| Molecular Formula | C23H50AlNO |
| Molecular Weight | 383.64 g/mol |
| Exact Mass | 383.37 |
| IUPAC Name | 1-dioctylalumanyloxy-N,N-diethylpropan-1-amine |
| SMILES | CCCCCCCC[Al](CCCCCCCC)OC(CC)N(CC)CC |
| InChI | InChI=1S/2C8H17.C7H16NO.Al/c2*1-3-5-7-8-6-4-2;1-4-7(9)8(5-2)6-3;/h2*1,3-8H2,2H3;7H,4-6H2,1-3H3;/q;;-1;+1 |
| InChIKey | KGMCHJPCCKSZNC-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.64 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|