C11H26AlNO — CID 139905355
1-dimethylalumanyloxy-N,N-dipropylpropan-1-amine (PubChem CID 139905355) has the molecular formula C11H26AlNO and a molecular weight of 215.32 g/mol. Its IUPAC name is 1-dimethylalumanyloxy-N,N-dipropylpropan-1-amine.
| Compound Name | 1-dimethylalumanyloxy-N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 139905355 |
| Molecular Formula | C11H26AlNO |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.18 |
| IUPAC Name | 1-dimethylalumanyloxy-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)C(CC)O[Al](C)C |
| InChI | InChI=1S/C9H20NO.2CH3.Al/c1-4-7-10(8-5-2)9(11)6-3;;;/h9H,4-8H2,1-3H3;2*1H3;/q-1;;;+1 |
| InChIKey | CYUPRJWGBRMBCH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|