C16H36AlNO — CID 139905287
1-dipropylalumanyloxy-N,N-dipropylbutan-1-amine (PubChem CID 139905287) has the molecular formula C16H36AlNO and a molecular weight of 285.45 g/mol. Its IUPAC name is 1-dipropylalumanyloxy-N,N-dipropylbutan-1-amine.
| Compound Name | 1-dipropylalumanyloxy-N,N-dipropylbutan-1-amine |
|---|---|
| PubChem CID | 139905287 |
| Molecular Formula | C16H36AlNO |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.26 |
| IUPAC Name | 1-dipropylalumanyloxy-N,N-dipropylbutan-1-amine |
| SMILES | CCCC(O[Al](CCC)CCC)N(CCC)CCC |
| InChI | InChI=1S/C10H22NO.2C3H7.Al/c1-4-7-10(12)11(8-5-2)9-6-3;2*1-3-2;/h10H,4-9H2,1-3H3;2*1,3H2,2H3;/q-1;;;+1 |
| InChIKey | VJVNDTHOGLJJRC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|