About 1-diethylalumanyloxy-N,N-di(propan-2-yl)butan-1-amine
1-diethylalumanyloxy-N,N-di(propan-2-yl)butan-1-amine (PubChem CID 139905081) has the molecular formula C14H32AlNO
and a molecular weight of 257.40 g/mol. Its IUPAC name is 1-diethylalumanyloxy-N,N-di(propan-2-yl)butan-1-amine.
Molecular Properties
| Compound Name | 1-diethylalumanyloxy-N,N-di(propan-2-yl)butan-1-amine |
| PubChem CID | 139905081 |
| Molecular Formula | C14H32AlNO |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.23 |
| IUPAC Name | 1-diethylalumanyloxy-N,N-di(propan-2-yl)butan-1-amine |
| SMILES | CCCC(O[Al](CC)CC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C10H22NO.2C2H5.Al/c1-6-7-10(12)11(8(2)3)9(4)5;2*1-2;/h8-10H,6-7H2,1-5H3;2*1H2,2H3;/q-1;;;+1 |
| InChIKey | NZOVRFQTGUVUOJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-diethylalumanyloxy-N,N-di(propan-2-yl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diethylalumanyloxy-N,N-di(propan-2-yl)butan-1-amine?
The IUPAC name of 1-diethylalumanyloxy-N,N-di(propan-2-yl)butan-1-amine (CID 139905081) is 1-diethylalumanyloxy-N,N-di(propan-2-yl)butan-1-amine.
What is the SMILES notation for 1-diethylalumanyloxy-N,N-di(propan-2-yl)butan-1-amine?
The canonical SMILES for 1-diethylalumanyloxy-N,N-di(propan-2-yl)butan-1-amine is CCCC(O[Al](CC)CC)N(C(C)C)C(C)C.
What is the InChIKey of 1-diethylalumanyloxy-N,N-di(propan-2-yl)butan-1-amine?
The InChIKey is NZOVRFQTGUVUOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22NO.2C2H5.Al/c1-6-7-10(12)11(8(2)3)9(4)5;2*1-2;/h8-10H,6-7H2,1-5H3;2*1H2,2H3;/q-1;;;+1.
What are the key properties of 1-diethylalumanyloxy-N,N-di(propan-2-yl)butan-1-amine?
1-diethylalumanyloxy-N,N-di(propan-2-yl)butan-1-amine has a molecular weight of 257.40 g/mol, XLogP of 4.28, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diethylalumanyloxy-N,N-di(propan-2-yl)butan-1-amine is sourced from PubChem (CID 139905081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).