About 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine
1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine (PubChem CID 139905082) has the molecular formula C20H44AlNO
and a molecular weight of 341.56 g/mol. Its IUPAC name is 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine.
Molecular Properties
| Compound Name | 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine |
| PubChem CID | 139905082 |
| Molecular Formula | C20H44AlNO |
| Molecular Weight | 341.56 g/mol |
| Exact Mass | 341.32 |
| IUPAC Name | 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine |
| SMILES | CCCCN(CCCC)C(CCC)O[Al](CC(C)C)CC(C)C |
| InChI | InChI=1S/C12H26NO.2C4H9.Al/c1-4-7-10-13(11-8-5-2)12(14)9-6-3;2*1-4(2)3;/h12H,4-11H2,1-3H3;2*4H,1H2,2-3H3;/q-1;;;+1 |
| InChIKey | NSJHDSTUDVZWTC-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.56 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine?
The IUPAC name of 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine (CID 139905082) is 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine.
What is the SMILES notation for 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine?
The canonical SMILES for 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine is CCCCN(CCCC)C(CCC)O[Al](CC(C)C)CC(C)C.
What is the InChIKey of 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine?
The InChIKey is NSJHDSTUDVZWTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26NO.2C4H9.Al/c1-4-7-10-13(11-8-5-2)12(14)9-6-3;2*1-4(2)3;/h12H,4-11H2,1-3H3;2*4H,1H2,2-3H3;/q-1;;;+1.
What are the key properties of 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine?
1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine has a molecular weight of 341.56 g/mol, XLogP of 6.33, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine is sourced from PubChem (CID 139905082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).