C20H44AlNO — CID 139905082
1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine (PubChem CID 139905082) has the molecular formula C20H44AlNO and a molecular weight of 341.56 g/mol. Its IUPAC name is 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine.
| Compound Name | 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine |
|---|---|
| PubChem CID | 139905082 |
| Molecular Formula | C20H44AlNO |
| Molecular Weight | 341.56 g/mol |
| Exact Mass | 341.32 |
| IUPAC Name | 1-[bis(2-methylpropyl)alumanyloxy]-N,N-dibutylbutan-1-amine |
| SMILES | CCCCN(CCCC)C(CCC)O[Al](CC(C)C)CC(C)C |
| InChI | InChI=1S/C12H26NO.2C4H9.Al/c1-4-7-10-13(11-8-5-2)12(14)9-6-3;2*1-4(2)3;/h12H,4-11H2,1-3H3;2*4H,1H2,2-3H3;/q-1;;;+1 |
| InChIKey | NSJHDSTUDVZWTC-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.56 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|