C17H34N2O — CID 20572574
1-(cyclododecylideneamino)oxy-N,N-dimethylpropan-1-amine (PubChem CID 20572574) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is 1-(cyclododecylideneamino)oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 1-(cyclododecylideneamino)oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 20572574 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 1-(cyclododecylideneamino)oxy-N,N-dimethylpropan-1-amine |
| SMILES | CCC(ON=C1CCCCCCCCCCC1)N(C)C |
| InChI | InChI=1S/C17H34N2O/c1-4-17(19(2)3)20-18-16-14-12-10-8-6-5-7-9-11-13-15-16/h17H,4-15H2,1-3H3 |
| InChIKey | CNMTZXZATJKCOV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|