C16H32N2O — CID 13205802
2-(cyclododecylideneamino)oxy-N,N-dimethylethanamine (PubChem CID 13205802) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is 2-(cyclododecylideneamino)oxy-N,N-dimethylethanamine.
| Compound Name | 2-(cyclododecylideneamino)oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 13205802 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 2-(cyclododecylideneamino)oxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCON=C1CCCCCCCCCCC1 |
| InChI | InChI=1S/C16H32N2O/c1-18(2)14-15-19-17-16-12-10-8-6-4-3-5-7-9-11-13-16/h3-15H2,1-2H3 |
| InChIKey | NVGXXXNUGIYECN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|