C19H38N2O — CID 13205810
3-(cyclododecylideneamino)oxy-N,N-diethylpropan-1-amine (PubChem CID 13205810) has the molecular formula C19H38N2O and a molecular weight of 310.53 g/mol. Its IUPAC name is 3-(cyclododecylideneamino)oxy-N,N-diethylpropan-1-amine.
| Compound Name | 3-(cyclododecylideneamino)oxy-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 13205810 |
| Molecular Formula | C19H38N2O |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.30 |
| IUPAC Name | 3-(cyclododecylideneamino)oxy-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCON=C1CCCCCCCCCCC1 |
| InChI | InChI=1S/C19H38N2O/c1-3-21(4-2)17-14-18-22-20-19-15-12-10-8-6-5-7-9-11-13-16-19/h3-18H2,1-2H3 |
| InChIKey | VPBZETYBRLPLSN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|