C18H45NO2Si3 — CID 140678672
1-[dimethoxy(methyl)silyl]-N,N-bis(triethylsilyl)propan-1-amine (PubChem CID 140678672) has the molecular formula C18H45NO2Si3 and a molecular weight of 391.82 g/mol. Its IUPAC name is 1-[dimethoxy(methyl)silyl]-N,N-bis(triethylsilyl)propan-1-amine.
| Compound Name | 1-[dimethoxy(methyl)silyl]-N,N-bis(triethylsilyl)propan-1-amine |
|---|---|
| PubChem CID | 140678672 |
| Molecular Formula | C18H45NO2Si3 |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | 1-[dimethoxy(methyl)silyl]-N,N-bis(triethylsilyl)propan-1-amine |
| SMILES | CCC(N([Si](CC)(CC)CC)[Si](CC)(CC)CC)[Si](C)(OC)OC |
| InChI | InChI=1S/C18H45NO2Si3/c1-11-18(22(10,20-8)21-9)19(23(12-2,13-3)14-4)24(15-5,16-6)17-7/h18H,11-17H2,1-10H3 |
| InChIKey | OXRORRUPMRTQEZ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|