C9H27NO6Si3 — CID 173127183
1-silyl-N,N-bis(trimethoxysilyl)propan-1-amine (PubChem CID 173127183) has the molecular formula C9H27NO6Si3 and a molecular weight of 329.57 g/mol. Its IUPAC name is 1-silyl-N,N-bis(trimethoxysilyl)propan-1-amine.
| Compound Name | 1-silyl-N,N-bis(trimethoxysilyl)propan-1-amine |
|---|---|
| PubChem CID | 173127183 |
| Molecular Formula | C9H27NO6Si3 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 1-silyl-N,N-bis(trimethoxysilyl)propan-1-amine |
| SMILES | CCC([SiH3])N([Si](OC)(OC)OC)[Si](OC)(OC)OC |
| InChI | InChI=1S/C9H27NO6Si3/c1-8-9(17)10(18(11-2,12-3)13-4)19(14-5,15-6)16-7/h9H,8H2,1-7,17H3 |
| InChIKey | RFJNIGJVXQZCMC-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|