C10H27N3O2Si — CID 19801524
N'-[2-[1-[dimethoxy(methyl)silyl]propylamino]ethyl]ethane-1,2-diamine (PubChem CID 19801524) has the molecular formula C10H27N3O2Si and a molecular weight of 249.43 g/mol. Its IUPAC name is N'-[2-[1-[dimethoxy(methyl)silyl]propylamino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[1-[dimethoxy(methyl)silyl]propylamino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 19801524 |
| Molecular Formula | C10H27N3O2Si |
| Molecular Weight | 249.43 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | N'-[2-[1-[dimethoxy(methyl)silyl]propylamino]ethyl]ethane-1,2-diamine |
| SMILES | CCC(NCCNCCN)[Si](C)(OC)OC |
| InChI | InChI=1S/C10H27N3O2Si/c1-5-10(16(4,14-2)15-3)13-9-8-12-7-6-11/h10,12-13H,5-9,11H2,1-4H3 |
| InChIKey | HKOONWKCFAWDSB-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.43 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|