C12H31N3O5Si — CID 174272810
acetic acid;N'-(2-aminoethyl)-N'-(1-trimethoxysilylpropyl)ethane-1,2-diamine (PubChem CID 174272810) has the molecular formula C12H31N3O5Si and a molecular weight of 325.48 g/mol. Its IUPAC name is acetic acid;N'-(2-aminoethyl)-N'-(1-trimethoxysilylpropyl)ethane-1,2-diamine.
| Compound Name | acetic acid;N'-(2-aminoethyl)-N'-(1-trimethoxysilylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 174272810 |
| Molecular Formula | C12H31N3O5Si |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | acetic acid;N'-(2-aminoethyl)-N'-(1-trimethoxysilylpropyl)ethane-1,2-diamine |
| SMILES | CC(=O)O.CCC(N(CCN)CCN)[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H27N3O3Si.C2H4O2/c1-5-10(13(8-6-11)9-7-12)17(14-2,15-3)16-4;1-2(3)4/h10H,5-9,11-12H2,1-4H3;1H3,(H,3,4) |
| InChIKey | HALUWPMHBDUKQO-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|