C20H48N2O6Si2 — CID 87274302
N',N'-bis(1-triethoxysilylpropyl)ethane-1,2-diamine (PubChem CID 87274302) has the molecular formula C20H48N2O6Si2 and a molecular weight of 468.78 g/mol. Its IUPAC name is N',N'-bis(1-triethoxysilylpropyl)ethane-1,2-diamine.
| Compound Name | N',N'-bis(1-triethoxysilylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 87274302 |
| Molecular Formula | C20H48N2O6Si2 |
| Molecular Weight | 468.78 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | N',N'-bis(1-triethoxysilylpropyl)ethane-1,2-diamine |
| SMILES | CCO[Si](OCC)(OCC)C(CC)N(CCN)C(CC)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C20H48N2O6Si2/c1-9-19(29(23-11-3,24-12-4)25-13-5)22(18-17-21)20(10-2)30(26-14-6,27-15-7)28-16-8/h19-20H,9-18,21H2,1-8H3 |
| InChIKey | OSRDTZJKNNUMRG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|