C10H25BN2O2 — CID 14742370
2-[2-(dimethylamino)ethoxy-ethylboranyl]oxy-N,N-dimethylethanamine (PubChem CID 14742370) has the molecular formula C10H25BN2O2 and a molecular weight of 216.13 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy-ethylboranyl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[2-(dimethylamino)ethoxy-ethylboranyl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 14742370 |
| Molecular Formula | C10H25BN2O2 |
| Molecular Weight | 216.13 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy-ethylboranyl]oxy-N,N-dimethylethanamine |
| SMILES | CCB(OCCN(C)C)OCCN(C)C |
| InChI | InChI=1S/C10H25BN2O2/c1-6-11(14-9-7-12(2)3)15-10-8-13(4)5/h6-10H2,1-5H3 |
| InChIKey | BDMMKVBRXWJLCB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.13 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|