About 2-(dimethylamino)ethyl hypoiodite
2-(dimethylamino)ethyl hypoiodite (PubChem CID 87171077) has the molecular formula C4H10INO
and a molecular weight of 215.03 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl hypoiodite.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl hypoiodite |
| PubChem CID | 87171077 |
| Molecular Formula | C4H10INO |
| Molecular Weight | 215.03 g/mol |
| Exact Mass | 214.98 |
| IUPAC Name | 2-(dimethylamino)ethyl hypoiodite |
| SMILES | CN(C)CCOI |
| InChI | InChI=1S/C4H10INO/c1-6(2)3-4-7-5/h3-4H2,1-2H3 |
| InChIKey | LKQACIQAZCPKHS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.03 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl hypoiodite?
The IUPAC name of 2-(dimethylamino)ethyl hypoiodite (CID 87171077) is 2-(dimethylamino)ethyl hypoiodite.
What is the SMILES notation for 2-(dimethylamino)ethyl hypoiodite?
The canonical SMILES for 2-(dimethylamino)ethyl hypoiodite is CN(C)CCOI.
What is the InChIKey of 2-(dimethylamino)ethyl hypoiodite?
The InChIKey is LKQACIQAZCPKHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10INO/c1-6(2)3-4-7-5/h3-4H2,1-2H3.
What are the key properties of 2-(dimethylamino)ethyl hypoiodite?
2-(dimethylamino)ethyl hypoiodite has a molecular weight of 215.03 g/mol, XLogP of 0.91, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl hypoiodite is sourced from PubChem (CID 87171077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).