About 2-(dimethylamino)ethyl dihydrogen phosphite
2-(dimethylamino)ethyl dihydrogen phosphite (PubChem CID 21448901) has the molecular formula C4H12NO3P
and a molecular weight of 153.12 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl dihydrogen phosphite.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl dihydrogen phosphite |
| PubChem CID | 21448901 |
| Molecular Formula | C4H12NO3P |
| Molecular Weight | 153.12 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 2-(dimethylamino)ethyl dihydrogen phosphite |
| SMILES | CN(C)CCOP(O)O |
| InChI | InChI=1S/C4H12NO3P/c1-5(2)3-4-8-9(6)7/h6-7H,3-4H2,1-2H3 |
| InChIKey | OXFADQJPQAKVRU-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.12 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl dihydrogen phosphite?
The IUPAC name of 2-(dimethylamino)ethyl dihydrogen phosphite (CID 21448901) is 2-(dimethylamino)ethyl dihydrogen phosphite.
What is the SMILES notation for 2-(dimethylamino)ethyl dihydrogen phosphite?
The canonical SMILES for 2-(dimethylamino)ethyl dihydrogen phosphite is CN(C)CCOP(O)O.
What is the InChIKey of 2-(dimethylamino)ethyl dihydrogen phosphite?
The InChIKey is OXFADQJPQAKVRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12NO3P/c1-5(2)3-4-8-9(6)7/h6-7H,3-4H2,1-2H3.
What are the key properties of 2-(dimethylamino)ethyl dihydrogen phosphite?
2-(dimethylamino)ethyl dihydrogen phosphite has a molecular weight of 153.12 g/mol, XLogP of -0.22, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl dihydrogen phosphite is sourced from PubChem (CID 21448901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).