C5H15NOSi — CID 123197397
N,N-dimethyl-2-methylsilyloxyethanamine (PubChem CID 123197397) has the molecular formula C5H15NOSi and a molecular weight of 133.27 g/mol. Its IUPAC name is N,N-dimethyl-2-methylsilyloxyethanamine.
| Compound Name | N,N-dimethyl-2-methylsilyloxyethanamine |
|---|---|
| PubChem CID | 123197397 |
| Molecular Formula | C5H15NOSi |
| Molecular Weight | 133.27 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | N,N-dimethyl-2-methylsilyloxyethanamine |
| SMILES | C[SiH2]OCCN(C)C |
| InChI | InChI=1S/C5H15NOSi/c1-6(2)4-5-7-8-3/h4-5,8H2,1-3H3 |
| InChIKey | NAZRZGYAENFWIA-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.27 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|