About 6-imino-5,5-dimethyl-3-oxocyclohexene-1-carbonitrile
6-imino-5,5-dimethyl-3-oxocyclohexene-1-carbonitrile (PubChem CID 57305149) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 6-imino-5,5-dimethyl-3-oxocyclohexene-1-carbonitrile.
Molecular Properties
| Compound Name | 6-imino-5,5-dimethyl-3-oxocyclohexene-1-carbonitrile |
| PubChem CID | 57305149 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 6-imino-5,5-dimethyl-3-oxocyclohexene-1-carbonitrile |
| SMILES | [H]/N=C1\C(C#N)=CC(=O)CC1(C)C |
| InChI | InChI=1S/C9H10N2O/c1-9(2)4-7(12)3-6(5-10)8(9)11/h3,11H,4H2,1-2H3/b11-8+ |
| InChIKey | YZUSSTJPOCBRLX-DHZHZOJOSA-N |
| XLogP | 1.46 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_E(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-imino-5,5-dimethyl-3-oxocyclohexene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-imino-5,5-dimethyl-3-oxocyclohexene-1-carbonitrile?
The IUPAC name of 6-imino-5,5-dimethyl-3-oxocyclohexene-1-carbonitrile (CID 57305149) is 6-imino-5,5-dimethyl-3-oxocyclohexene-1-carbonitrile.
What is the SMILES notation for 6-imino-5,5-dimethyl-3-oxocyclohexene-1-carbonitrile?
The canonical SMILES for 6-imino-5,5-dimethyl-3-oxocyclohexene-1-carbonitrile is [H]/N=C1\C(C#N)=CC(=O)CC1(C)C.
What is the InChIKey of 6-imino-5,5-dimethyl-3-oxocyclohexene-1-carbonitrile?
The InChIKey is YZUSSTJPOCBRLX-DHZHZOJOSA-N. The full InChI is InChI=1S/C9H10N2O/c1-9(2)4-7(12)3-6(5-10)8(9)11/h3,11H,4H2,1-2H3/b11-8+.
What are the key properties of 6-imino-5,5-dimethyl-3-oxocyclohexene-1-carbonitrile?
6-imino-5,5-dimethyl-3-oxocyclohexene-1-carbonitrile has a molecular weight of 162.19 g/mol, XLogP of 1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-imino-5,5-dimethyl-3-oxocyclohexene-1-carbonitrile is sourced from PubChem (CID 57305149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).