C21H23NO — CID 57305498
1-(2,2,4-trimethyl-4a,5,5a,11-tetrahydroindeno[1,2-g]quinolin-8-yl)ethanone (PubChem CID 57305498) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is 1-(2,2,4-trimethyl-4a,5,5a,11-tetrahydroindeno[1,2-g]quinolin-8-yl)ethanone.
| Compound Name | 1-(2,2,4-trimethyl-4a,5,5a,11-tetrahydroindeno[1,2-g]quinolin-8-yl)ethanone |
|---|---|
| PubChem CID | 57305498 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 1-(2,2,4-trimethyl-4a,5,5a,11-tetrahydroindeno[1,2-g]quinolin-8-yl)ethanone |
| SMILES | CC(=O)c1ccc2c(c1)C=C1CC3=NC(C)(C)C=C(C)C3CC12 |
| InChI | InChI=1S/C21H23NO/c1-12-11-21(3,4)22-20-9-16-8-15-7-14(13(2)23)5-6-17(15)19(16)10-18(12)20/h5-8,11,18-19H,9-10H2,1-4H3 |
| InChIKey | FWUKWGTYTFHRRH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|