C9H8N2O — CID 57305512
4,9-dihydro-1,2-benzodiazepin-6-one (PubChem CID 57305512) has the molecular formula C9H8N2O and a molecular weight of 160.18 g/mol. Its IUPAC name is 4,9-dihydro-1,2-benzodiazepin-6-one.
| Compound Name | 4,9-dihydro-1,2-benzodiazepin-6-one |
|---|---|
| PubChem CID | 57305512 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 4,9-dihydro-1,2-benzodiazepin-6-one |
| SMILES | O=C1C=CCC2=NN=CCC=C12 |
| InChI | InChI=1S/C9H8N2O/c12-9-5-1-4-8-7(9)3-2-6-10-11-8/h1,3,5-6H,2,4H2 |
| InChIKey | WQVJNPGBRXZJFN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |