About 6,7-dihydroindazol-5-one
6,7-dihydroindazol-5-one (PubChem CID 66617414) has the molecular formula C7H6N2O
and a molecular weight of 134.14 g/mol. Its IUPAC name is 6,7-dihydroindazol-5-one.
Molecular Properties
| Compound Name | 6,7-dihydroindazol-5-one |
| PubChem CID | 66617414 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 6,7-dihydroindazol-5-one |
| SMILES | O=C1C=C2C=NN=C2CC1 |
| InChI | InChI=1S/C7H6N2O/c10-6-1-2-7-5(3-6)4-8-9-7/h3-4H,1-2H2 |
| InChIKey | QSVSMNAYVRURDO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dihydroindazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydroindazol-5-one?
The IUPAC name of 6,7-dihydroindazol-5-one (CID 66617414) is 6,7-dihydroindazol-5-one.
What is the SMILES notation for 6,7-dihydroindazol-5-one?
The canonical SMILES for 6,7-dihydroindazol-5-one is O=C1C=C2C=NN=C2CC1.
What is the InChIKey of 6,7-dihydroindazol-5-one?
The InChIKey is QSVSMNAYVRURDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O/c10-6-1-2-7-5(3-6)4-8-9-7/h3-4H,1-2H2.
What are the key properties of 6,7-dihydroindazol-5-one?
6,7-dihydroindazol-5-one has a molecular weight of 134.14 g/mol, XLogP of 0.72, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydroindazol-5-one is sourced from PubChem (CID 66617414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).