C10H20N2 — CID 57306164
3-butyl-1,2,4-trimethyl-2H-imidazole (PubChem CID 57306164) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 3-butyl-1,2,4-trimethyl-2H-imidazole.
| Compound Name | 3-butyl-1,2,4-trimethyl-2H-imidazole |
|---|---|
| PubChem CID | 57306164 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 3-butyl-1,2,4-trimethyl-2H-imidazole |
| SMILES | CCCCN1C(C)=CN(C)C1C |
| InChI | InChI=1S/C10H20N2/c1-5-6-7-12-9(2)8-11(4)10(12)3/h8,10H,5-7H2,1-4H3 |
| InChIKey | FGPLQZKIMQDRLD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |