C27H31N3O8 — CID 57307372
[amino-[4-[4-[[(2S,4S)-4-(2-methoxy-2-oxoethyl)-5-oxopyrrolidin-2-yl]methoxy]phenyl]phenyl]methylidene]carbamoyloxymethyl butanoate (PubChem CID 57307372) has the molecular formula C27H31N3O8 and a molecular weight of 525.56 g/mol. Its IUPAC name is [amino-[4-[4-[[(2S,4S)-4-(2-methoxy-2-oxoethyl)-5-oxopyrrolidin-2-yl]methoxy]phenyl]phenyl]methylidene]carbamoyloxymethyl butanoate.
| Compound Name | [amino-[4-[4-[[(2S,4S)-4-(2-methoxy-2-oxoethyl)-5-oxopyrrolidin-2-yl]methoxy]phenyl]phenyl]methylidene]carbamoyloxymethyl butanoate |
|---|---|
| PubChem CID | 57307372 |
| Molecular Formula | C27H31N3O8 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | [amino-[4-[4-[[(2S,4S)-4-(2-methoxy-2-oxoethyl)-5-oxopyrrolidin-2-yl]methoxy]phenyl]phenyl]methylidene]carbamoyloxymethyl butanoate |
| SMILES | CCCC(=O)OCOC(=O)N=C(N)c1ccc(-c2ccc(OC[C@@H]3C[C@@H](CC(=O)OC)C(=O)N3)cc2)cc1 |
| InChI | InChI=1S/C27H31N3O8/c1-3-4-23(31)37-16-38-27(34)30-25(28)19-7-5-17(6-8-19)18-9-11-22(12-10-18)36-15-21-13-20(26(33)29-21)14-24(32)35-2/h5-12,20-21H,3-4,13-16H2,1-2H3,(H,29,33)(H2,28,30,34)/t20-,21-/m0/s1 |
| InChIKey | WCVLRSKSZDHOGO-SFTDATJTSA-N |
| XLogP | 2.94 |
| TPSA | 155.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|