C9H8N2O3 — CID 57308875
3-(2-nitrophenyl)-2,5-dihydro-1,2-oxazole (PubChem CID 57308875) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is 3-(2-nitrophenyl)-2,5-dihydro-1,2-oxazole.
| Compound Name | 3-(2-nitrophenyl)-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 57308875 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 3-(2-nitrophenyl)-2,5-dihydro-1,2-oxazole |
| SMILES | O=[N+]([O-])c1ccccc1C1=CCON1 |
| InChI | InChI=1S/C9H8N2O3/c12-11(13)9-4-2-1-3-7(9)8-5-6-14-10-8/h1-5,10H,6H2 |
| InChIKey | SHHNBIHKOLTISF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|