About 4-methyl-3-nitroaniline
4-methyl-3-nitroaniline (PubChem CID 8390) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 4-methyl-3-nitroaniline.
Molecular Properties
| Compound Name | 4-methyl-3-nitroaniline |
| PubChem CID | 8390 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 4-methyl-3-nitroaniline |
| SMILES | Cc1ccc(N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H8N2O2/c1-5-2-3-6(8)4-7(5)9(10)11/h2-4H,8H2,1H3 |
| InChIKey | GDIIPKWHAQGCJF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-nitroaniline?
The IUPAC name of 4-methyl-3-nitroaniline (CID 8390) is 4-methyl-3-nitroaniline.
What is the SMILES notation for 4-methyl-3-nitroaniline?
The canonical SMILES for 4-methyl-3-nitroaniline is Cc1ccc(N)cc1[N+](=O)[O-].
What is the InChIKey of 4-methyl-3-nitroaniline?
The InChIKey is GDIIPKWHAQGCJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c1-5-2-3-6(8)4-7(5)9(10)11/h2-4H,8H2,1H3.
What are the key properties of 4-methyl-3-nitroaniline?
4-methyl-3-nitroaniline has a molecular weight of 152.15 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-nitroaniline is sourced from PubChem (CID 8390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).