C21H32N4O4 — CID 57309222
ethyl 3-[4-[(4-piperidin-4-ylpiperazine-1-carbonyl)amino]phenoxy]propanoate (PubChem CID 57309222) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is ethyl 3-[4-[(4-piperidin-4-ylpiperazine-1-carbonyl)amino]phenoxy]propanoate.
| Compound Name | ethyl 3-[4-[(4-piperidin-4-ylpiperazine-1-carbonyl)amino]phenoxy]propanoate |
|---|---|
| PubChem CID | 57309222 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | ethyl 3-[4-[(4-piperidin-4-ylpiperazine-1-carbonyl)amino]phenoxy]propanoate |
| SMILES | CCOC(=O)CCOc1ccc(NC(=O)N2CCN(C3CCNCC3)CC2)cc1 |
| InChI | InChI=1S/C21H32N4O4/c1-2-28-20(26)9-16-29-19-5-3-17(4-6-19)23-21(27)25-14-12-24(13-15-25)18-7-10-22-11-8-18/h3-6,18,22H,2,7-16H2,1H3,(H,23,27) |
| InChIKey | UIUVQUQXBRDLJE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |