C19H29N5O3 — CID 67762871
methyl 2-[4-[(4-piperidin-4-ylpiperazine-1-carbonyl)amino]anilino]acetate (PubChem CID 67762871) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is methyl 2-[4-[(4-piperidin-4-ylpiperazine-1-carbonyl)amino]anilino]acetate.
| Compound Name | methyl 2-[4-[(4-piperidin-4-ylpiperazine-1-carbonyl)amino]anilino]acetate |
|---|---|
| PubChem CID | 67762871 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | methyl 2-[4-[(4-piperidin-4-ylpiperazine-1-carbonyl)amino]anilino]acetate |
| SMILES | COC(=O)CNc1ccc(NC(=O)N2CCN(C3CCNCC3)CC2)cc1 |
| InChI | InChI=1S/C19H29N5O3/c1-27-18(25)14-21-15-2-4-16(5-3-15)22-19(26)24-12-10-23(11-13-24)17-6-8-20-9-7-17/h2-5,17,20-21H,6-14H2,1H3,(H,22,26) |
| InChIKey | OKLQANTYBFJULV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |