C32H47N5O6S2 — CID 57310449
N-[(2R)-2-hydroxy-3-[[[2-(2-methoxyethylamino)acetyl]amino]-[(3S)-3-methylpentanoyl]amino]-4-phenylbutyl]-N-(2-methylpropyl)-1,3-benzothiazole-6-sulfonamide (PubChem CID 57310449) has the molecular formula C32H47N5O6S2 and a molecular weight of 661.89 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-3-[[[2-(2-methoxyethylamino)acetyl]amino]-[(3S)-3-methylpentanoyl]amino]-4-phenylbutyl]-N-(2-methylpropyl)-1,3-benzothiazole-6-sulfonamide.
| Compound Name | N-[(2R)-2-hydroxy-3-[[[2-(2-methoxyethylamino)acetyl]amino]-[(3S)-3-methylpentanoyl]amino]-4-phenylbutyl]-N-(2-methylpropyl)-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 57310449 |
| Molecular Formula | C32H47N5O6S2 |
| Molecular Weight | 661.89 g/mol |
| Exact Mass | 661.30 |
| IUPAC Name | N-[(2R)-2-hydroxy-3-[[[2-(2-methoxyethylamino)acetyl]amino]-[(3S)-3-methylpentanoyl]amino]-4-phenylbutyl]-N-(2-methylpropyl)-1,3-benzothiazole-6-sulfonamide |
| SMILES | CC[C@H](C)CC(=O)N(NC(=O)CNCCOC)C(Cc1ccccc1)[C@H](O)CN(CC(C)C)S(=O)(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C32H47N5O6S2/c1-6-24(4)16-32(40)37(35-31(39)19-33-14-15-43-5)28(17-25-10-8-7-9-11-25)29(38)21-36(20-23(2)3)45(41,42)26-12-13-27-30(18-26)44-22-34-27/h7-13,18,22-24,28-29,33,38H,6,14-17,19-21H2,1-5H3,(H,35,39)/t24-,28?,29+/m0/s1 |
| InChIKey | QWTUWGQPLRDCGZ-QLMXRQDHSA-N |
| XLogP | 3.45 |
| TPSA | 141.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.89 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|