C35H50N4O6S — CID 69263425
N-[(2R,3S)-3-[3,3-dimethylbutanoyl-[[2-(2-methoxyethylamino)acetyl]amino]amino]-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)naphthalene-2-sulfonamide (PubChem CID 69263425) has the molecular formula C35H50N4O6S and a molecular weight of 654.87 g/mol. Its IUPAC name is N-[(2R,3S)-3-[3,3-dimethylbutanoyl-[[2-(2-methoxyethylamino)acetyl]amino]amino]-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)naphthalene-2-sulfonamide.
| Compound Name | N-[(2R,3S)-3-[3,3-dimethylbutanoyl-[[2-(2-methoxyethylamino)acetyl]amino]amino]-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 69263425 |
| Molecular Formula | C35H50N4O6S |
| Molecular Weight | 654.87 g/mol |
| Exact Mass | 654.35 |
| IUPAC Name | N-[(2R,3S)-3-[3,3-dimethylbutanoyl-[[2-(2-methoxyethylamino)acetyl]amino]amino]-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)naphthalene-2-sulfonamide |
| SMILES | COCCNCC(=O)NN(C(=O)CC(C)(C)C)[C@@H](Cc1ccccc1)[C@H](O)CN(CC(C)C)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C35H50N4O6S/c1-26(2)24-38(46(43,44)30-17-16-28-14-10-11-15-29(28)21-30)25-32(40)31(20-27-12-8-7-9-13-27)39(34(42)22-35(3,4)5)37-33(41)23-36-18-19-45-6/h7-17,21,26,31-32,36,40H,18-20,22-25H2,1-6H3,(H,37,41)/t31-,32+/m0/s1 |
| InChIKey | ULAIUXSYHRWLKP-AJQTZOPKSA-N |
| XLogP | 3.99 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.87 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|