C34H32F3N6O3S+ — CID 57312040
[4-[[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-hydroxy-2-(2,4,5-trifluorophenyl)butyl]-1,2,4-triazol-4-ium-4-yl]methyl]-2,6-dimethylphenyl] 2-(methylamino)acetate (PubChem CID 57312040) has the molecular formula C34H32F3N6O3S+ and a molecular weight of 661.73 g/mol. Its IUPAC name is [4-[[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-hydroxy-2-(2,4,5-trifluorophenyl)butyl]-1,2,4-triazol-4-ium-4-yl]methyl]-2,6-dimethylphenyl] 2-(methylamino)acetate.
| Compound Name | [4-[[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-hydroxy-2-(2,4,5-trifluorophenyl)butyl]-1,2,4-triazol-4-ium-4-yl]methyl]-2,6-dimethylphenyl] 2-(methylamino)acetate |
|---|---|
| PubChem CID | 57312040 |
| Molecular Formula | C34H32F3N6O3S+ |
| Molecular Weight | 661.73 g/mol |
| Exact Mass | 661.22 |
| IUPAC Name | [4-[[1-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-hydroxy-2-(2,4,5-trifluorophenyl)butyl]-1,2,4-triazol-4-ium-4-yl]methyl]-2,6-dimethylphenyl] 2-(methylamino)acetate |
| SMILES | CNCC(=O)Oc1c(C)cc(C[n+]2cnn(C[C@](O)(c3cc(F)c(F)cc3F)[C@@H](C)c3nc(-c4ccc(C#N)cc4)cs3)c2)cc1C |
| InChI | InChI=1S/C34H32F3N6O3S/c1-20-9-24(10-21(2)32(20)46-31(44)14-39-4)15-42-18-40-43(19-42)17-34(45,26-11-28(36)29(37)12-27(26)35)22(3)33-41-30(16-47-33)25-7-5-23(13-38)6-8-25/h5-12,16,18-19,22,39,45H,14-15,17H2,1-4H3/q+1/t22-,34+/m0/s1 |
| InChIKey | XKORUUIBWZYDEF-XSJBNIOMSA-N |
| XLogP | 5.06 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.73 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|