C36H38F2N6O3S — CID 142626621
[4-[[2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-2-hydroxybutyl]-3H-1,2,4-triazol-4-yl]methyl]-2,6-dimethylphenyl] (2S)-2-amino-3-methylbutanoate (PubChem CID 142626621) has the molecular formula C36H38F2N6O3S and a molecular weight of 672.80 g/mol. Its IUPAC name is [4-[[2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-2-hydroxybutyl]-3H-1,2,4-triazol-4-yl]methyl]-2,6-dimethylphenyl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [4-[[2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-2-hydroxybutyl]-3H-1,2,4-triazol-4-yl]methyl]-2,6-dimethylphenyl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 142626621 |
| Molecular Formula | C36H38F2N6O3S |
| Molecular Weight | 672.80 g/mol |
| Exact Mass | 672.27 |
| IUPAC Name | [4-[[2-[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-2-hydroxybutyl]-3H-1,2,4-triazol-4-yl]methyl]-2,6-dimethylphenyl] (2S)-2-amino-3-methylbutanoate |
| SMILES | Cc1cc(CN2C=NN(C[C@](O)(c3ccc(F)cc3F)[C@@H](C)c3nc(-c4ccc(C#N)cc4)cs3)C2)cc(C)c1OC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C36H38F2N6O3S/c1-21(2)32(40)35(45)47-33-22(3)12-26(13-23(33)4)16-43-19-41-44(20-43)18-36(46,29-11-10-28(37)14-30(29)38)24(5)34-42-31(17-48-34)27-8-6-25(15-39)7-9-27/h6-14,17,19,21,24,32,46H,16,18,20,40H2,1-5H3/t24-,32-,36+/m0/s1 |
| InChIKey | GRIXFPJUFCXRFL-WRGRQLSNSA-N |
| XLogP | 6.18 |
| TPSA | 128.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.80 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|