C24H18F2IN5O3S — CID 12046104
[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] iodomethyl carbonate (PubChem CID 12046104) has the molecular formula C24H18F2IN5O3S and a molecular weight of 621.41 g/mol. Its IUPAC name is [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] iodomethyl carbonate.
| Compound Name | [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] iodomethyl carbonate |
|---|---|
| PubChem CID | 12046104 |
| Molecular Formula | C24H18F2IN5O3S |
| Molecular Weight | 621.41 g/mol |
| Exact Mass | 621.01 |
| IUPAC Name | [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl] iodomethyl carbonate |
| SMILES | C[C@@H](c1nc(-c2ccc(C#N)cc2)cs1)[C@@](Cn1cncn1)(OC(=O)OCI)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H18F2IN5O3S/c1-15(22-31-21(10-36-22)17-4-2-16(9-28)3-5-17)24(35-23(33)34-12-27,11-32-14-29-13-30-32)19-7-6-18(25)8-20(19)26/h2-8,10,13-15H,11-12H2,1H3/t15-,24+/m0/s1 |
| InChIKey | CHGBOVIRAJTLNH-IZHWHUGBSA-N |
| XLogP | 5.80 |
| TPSA | 102.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|