C38H38F2N6O3S — CID 70160692
[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 4-[(2,2-dimethylpiperidin-1-yl)methyl]benzoate (PubChem CID 70160692) has the molecular formula C38H38F2N6O3S and a molecular weight of 696.82 g/mol. Its IUPAC name is [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 4-[(2,2-dimethylpiperidin-1-yl)methyl]benzoate.
| Compound Name | [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 4-[(2,2-dimethylpiperidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 70160692 |
| Molecular Formula | C38H38F2N6O3S |
| Molecular Weight | 696.82 g/mol |
| Exact Mass | 696.27 |
| IUPAC Name | [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 4-[(2,2-dimethylpiperidin-1-yl)methyl]benzoate |
| SMILES | C[C@@H](c1nc(-c2ccc(C#N)cc2)cs1)[C@@](Cn1cncn1)(OCOC(=O)c1ccc(CN2CCCCC2(C)C)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C38H38F2N6O3S/c1-26(35-44-34(21-50-35)29-10-6-27(19-41)7-11-29)38(22-46-24-42-23-43-46,32-15-14-31(39)18-33(32)40)49-25-48-36(47)30-12-8-28(9-13-30)20-45-17-5-4-16-37(45,2)3/h6-15,18,21,23-24,26H,4-5,16-17,20,22,25H2,1-3H3/t26-,38+/m0/s1 |
| InChIKey | YXZCNQQYEUGPGE-MGGKRHIHSA-N |
| XLogP | 7.85 |
| TPSA | 106.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.82 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|