C35H36F2N6O3S — CID 70162090
[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 4-methylbenzoate;N-ethylethanamine (PubChem CID 70162090) has the molecular formula C35H36F2N6O3S and a molecular weight of 658.78 g/mol. Its IUPAC name is [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 4-methylbenzoate;N-ethylethanamine.
| Compound Name | [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 4-methylbenzoate;N-ethylethanamine |
|---|---|
| PubChem CID | 70162090 |
| Molecular Formula | C35H36F2N6O3S |
| Molecular Weight | 658.78 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 4-methylbenzoate;N-ethylethanamine |
| SMILES | CCNCC.Cc1ccc(C(=O)OCO[C@@](Cn2cncn2)(c2ccc(F)cc2F)[C@@H](C)c2nc(-c3ccc(C#N)cc3)cs2)cc1 |
| InChI | InChI=1S/C31H25F2N5O3S.C4H11N/c1-20-3-7-24(8-4-20)30(39)40-19-41-31(16-38-18-35-17-36-38,26-12-11-25(32)13-27(26)33)21(2)29-37-28(15-42-29)23-9-5-22(14-34)6-10-23;1-3-5-4-2/h3-13,15,17-18,21H,16,19H2,1-2H3;5H,3-4H2,1-2H3/t21-,31+;/m0./s1 |
| InChIKey | MSNVIRQERIRYKL-VKVBQESRSA-N |
| XLogP | 7.01 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.78 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|