C36H32F2N6O6S — CID 12046106
[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxycarbonyloxymethyl 4-(morpholin-4-ylmethyl)benzoate (PubChem CID 12046106) has the molecular formula C36H32F2N6O6S and a molecular weight of 714.75 g/mol. Its IUPAC name is [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxycarbonyloxymethyl 4-(morpholin-4-ylmethyl)benzoate.
| Compound Name | [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxycarbonyloxymethyl 4-(morpholin-4-ylmethyl)benzoate |
|---|---|
| PubChem CID | 12046106 |
| Molecular Formula | C36H32F2N6O6S |
| Molecular Weight | 714.75 g/mol |
| Exact Mass | 714.21 |
| IUPAC Name | [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxycarbonyloxymethyl 4-(morpholin-4-ylmethyl)benzoate |
| SMILES | C[C@@H](c1nc(-c2ccc(C#N)cc2)cs1)[C@@](Cn1cncn1)(OC(=O)OCOC(=O)c1ccc(CN2CCOCC2)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C36H32F2N6O6S/c1-24(33-42-32(19-51-33)27-6-2-25(17-39)3-7-27)36(20-44-22-40-21-41-44,30-11-10-29(37)16-31(30)38)50-35(46)49-23-48-34(45)28-8-4-26(5-9-28)18-43-12-14-47-15-13-43/h2-11,16,19,21-22,24H,12-15,18,20,23H2,1H3/t24-,36+/m0/s1 |
| InChIKey | ZJZLGHJISRUVMX-XAIPSOGISA-N |
| XLogP | 6.05 |
| TPSA | 141.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.75 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|