C24H20F2IN5O3S — CID 18710273
[2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl] iodomethyl carbonate (PubChem CID 18710273) has the molecular formula C24H20F2IN5O3S and a molecular weight of 623.42 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl] iodomethyl carbonate.
| Compound Name | [2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl] iodomethyl carbonate |
|---|---|
| PubChem CID | 18710273 |
| Molecular Formula | C24H20F2IN5O3S |
| Molecular Weight | 623.42 g/mol |
| Exact Mass | 623.03 |
| IUPAC Name | [2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl] iodomethyl carbonate |
| SMILES | C=Nc1ccc(-c2csc(C(C)C(Cn3cncn3)(OC(=O)OCI)c3ccc(F)cc3F)n2)cc1 |
| InChI | InChI=1S/C24H20F2IN5O3S/c1-15(22-31-21(10-36-22)16-3-6-18(28-2)7-4-16)24(35-23(33)34-12-27,11-32-14-29-13-30-32)19-8-5-17(25)9-20(19)26/h3-10,13-15H,2,11-12H2,1H3 |
| InChIKey | UTTKYABZTFCSSD-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 91.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.42 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|