C22H18F2N5Na2O4PS — CID 59966589
disodium;[(3R)-2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl] phosphate (PubChem CID 59966589) has the molecular formula C22H18F2N5Na2O4PS and a molecular weight of 563.43 g/mol. Its IUPAC name is disodium;[(3R)-2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl] phosphate.
| Compound Name | disodium;[(3R)-2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl] phosphate |
|---|---|
| PubChem CID | 59966589 |
| Molecular Formula | C22H18F2N5Na2O4PS |
| Molecular Weight | 563.43 g/mol |
| Exact Mass | 563.06 |
| IUPAC Name | disodium;[(3R)-2-(2,4-difluorophenyl)-3-[4-[4-(methylideneamino)phenyl]-1,3-thiazol-2-yl]-1-(1,2,4-triazol-1-yl)butan-2-yl] phosphate |
| SMILES | C=Nc1ccc(-c2csc([C@H](C)C(Cn3cncn3)(OP(=O)([O-])[O-])c3ccc(F)cc3F)n2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C22H20F2N5O4PS.2Na/c1-14(21-28-20(10-35-21)15-3-6-17(25-2)7-4-15)22(33-34(30,31)32,11-29-13-26-12-27-29)18-8-5-16(23)9-19(18)24;;/h3-10,12-14H,2,11H2,1H3,(H2,30,31,32);;/q;2*+1/p-2/t14-,22?;;/m0../s1 |
| InChIKey | FXSXQKNXPGRFIC-UTTGIEMOSA-L |
| XLogP | -2.44 |
| TPSA | 128.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.43 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|