C35H42F2N5O5PS — CID 143323389
tert-butyl [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl [2-methyl-1-(1-methylcyclopropyl)propan-2-yl] phosphate (PubChem CID 143323389) has the molecular formula C35H42F2N5O5PS and a molecular weight of 713.79 g/mol. Its IUPAC name is tert-butyl [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl [2-methyl-1-(1-methylcyclopropyl)propan-2-yl] phosphate.
| Compound Name | tert-butyl [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl [2-methyl-1-(1-methylcyclopropyl)propan-2-yl] phosphate |
|---|---|
| PubChem CID | 143323389 |
| Molecular Formula | C35H42F2N5O5PS |
| Molecular Weight | 713.79 g/mol |
| Exact Mass | 713.26 |
| IUPAC Name | tert-butyl [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl [2-methyl-1-(1-methylcyclopropyl)propan-2-yl] phosphate |
| SMILES | C[C@@H](c1nc(-c2ccc(C#N)cc2)cs1)[C@@](Cn1cncn1)(OCOP(=O)(OC(C)(C)C)OC(C)(C)CC1(C)CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C35H42F2N5O5PS/c1-24(31-41-30(18-49-31)26-10-8-25(17-38)9-11-26)35(20-42-22-39-21-40-42,28-13-12-27(36)16-29(28)37)44-23-45-48(43,46-32(2,3)4)47-33(5,6)19-34(7)14-15-34/h8-13,16,18,21-22,24H,14-15,19-20,23H2,1-7H3/t24-,35+,48?/m0/s1 |
| InChIKey | VMBNOTWCJICYJH-UODYNMFLSA-N |
| XLogP | 9.15 |
| TPSA | 121.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.79 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|