C32H28F2N5O5PS — CID 59914743
[(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 3-dimethylphosphoryloxybenzoate (PubChem CID 59914743) has the molecular formula C32H28F2N5O5PS and a molecular weight of 663.64 g/mol. Its IUPAC name is [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 3-dimethylphosphoryloxybenzoate.
| Compound Name | [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 3-dimethylphosphoryloxybenzoate |
|---|---|
| PubChem CID | 59914743 |
| Molecular Formula | C32H28F2N5O5PS |
| Molecular Weight | 663.64 g/mol |
| Exact Mass | 663.15 |
| IUPAC Name | [(2R,3R)-3-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butan-2-yl]oxymethyl 3-dimethylphosphoryloxybenzoate |
| SMILES | C[C@@H](c1nc(-c2ccc(C#N)cc2)cs1)[C@@](Cn1cncn1)(OCOC(=O)c1cccc(OP(C)(C)=O)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C32H28F2N5O5PS/c1-21(30-38-29(16-46-30)23-9-7-22(15-35)8-10-23)32(17-39-19-36-18-37-39,27-12-11-25(33)14-28(27)34)43-20-42-31(40)24-5-4-6-26(13-24)44-45(2,3)41/h4-14,16,18-19,21H,17,20H2,1-3H3/t21-,32+/m0/s1 |
| InChIKey | LUQKDQJVBPMXTJ-GFJKYASSSA-N |
| XLogP | 7.00 |
| TPSA | 129.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.64 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|